C31H40FN4O5+ — CID 144998043
5-tert-butyl-N-methyl-1,2-oxazol-3-amine;N-[4-[2-[2-fluoro-4-[3-(4-methoxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]phenyl]formamide (PubChem CID 144998043) has the molecular formula C31H40FN4O5+ and a molecular weight of 567.68 g/mol. Its IUPAC name is 5-tert-butyl-N-methyl-1,2-oxazol-3-amine;N-[4-[2-[2-fluoro-4-[3-(4-methoxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]phenyl]formamide.
| Compound Name | 5-tert-butyl-N-methyl-1,2-oxazol-3-amine;N-[4-[2-[2-fluoro-4-[3-(4-methoxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]phenyl]formamide |
|---|---|
| PubChem CID | 144998043 |
| Molecular Formula | C31H40FN4O5+ |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 5-tert-butyl-N-methyl-1,2-oxazol-3-amine;N-[4-[2-[2-fluoro-4-[3-(4-methoxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]phenyl]formamide |
| SMILES | CNc1cc(C(C)(C)C)on1.CO[N+]1(CCCOc2ccc(C#Cc3ccc(NC=O)cc3)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C23H25FN2O4.C8H14N2O/c1-28-26(12-15-29-16-13-26)11-2-14-30-22-10-7-20(23(24)17-22)6-3-19-4-8-21(9-5-19)25-18-27;1-8(2,3)6-5-7(9-4)10-11-6/h4-5,7-10,17-18H,2,11-16H2,1H3;5H,1-4H3,(H,9,10)/p+1 |
| InChIKey | CGNQCMCQMAONHG-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|