C22H33ClN2O3 — CID 139419615
tert-butyl (2R,5S)-2-[(R)-(6-chloro-3-pyridinyl)-hydroxymethyl]-5-[(Z)-hept-4-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 139419615) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-[(R)-(6-chloro-3-pyridinyl)-hydroxymethyl]-5-[(Z)-hept-4-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-2-[(R)-(6-chloro-3-pyridinyl)-hydroxymethyl]-5-[(Z)-hept-4-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139419615 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl (2R,5S)-2-[(R)-(6-chloro-3-pyridinyl)-hydroxymethyl]-5-[(Z)-hept-4-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC/C=C\CC(C)[C@@H]1CC[C@H]([C@H](O)c2ccc(Cl)nc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33ClN2O3/c1-6-7-8-9-15(2)17-11-12-18(25(17)21(27)28-22(3,4)5)20(26)16-10-13-19(23)24-14-16/h7-8,10,13-15,17-18,20,26H,6,9,11-12H2,1-5H3/b8-7-/t15?,17-,18+,20+/m0/s1 |
| InChIKey | VPSOBAQWVNRYBK-GDCZPBOSSA-N |
| XLogP | 5.53 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|