C22H24BrN3O4 — CID 139423241
tert-butyl N-[3-[[3-[[(E)-4-bromobut-2-enoyl]amino]benzoyl]amino]phenyl]carbamate (PubChem CID 139423241) has the molecular formula C22H24BrN3O4 and a molecular weight of 474.36 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-[[(E)-4-bromobut-2-enoyl]amino]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-[[(E)-4-bromobut-2-enoyl]amino]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 139423241 |
| Molecular Formula | C22H24BrN3O4 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | tert-butyl N-[3-[[3-[[(E)-4-bromobut-2-enoyl]amino]benzoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC(=O)c2cccc(NC(=O)/C=C/CBr)c2)c1 |
| InChI | InChI=1S/C22H24BrN3O4/c1-22(2,3)30-21(29)26-18-10-5-9-17(14-18)25-20(28)15-7-4-8-16(13-15)24-19(27)11-6-12-23/h4-11,13-14H,12H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)/b11-6+ |
| InChIKey | FWZLKSPQSZJRHS-IZZDOVSWSA-N |
| XLogP | 5.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|