C19H27ClN4O2 — CID 139425087
2-chloro-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxamide (PubChem CID 139425087) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxamide.
| Compound Name | 2-chloro-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 139425087 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-chloro-N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxamide |
| SMILES | CCC1NC(c2ccc3c(c2)CC[C@H]3NC(=O)C2CCNC(Cl)C2)NO1 |
| InChI | InChI=1S/C19H27ClN4O2/c1-2-17-23-18(24-26-17)12-3-5-14-11(9-12)4-6-15(14)22-19(25)13-7-8-21-16(20)10-13/h3,5,9,13,15-18,21,23-24H,2,4,6-8,10H2,1H3,(H,22,25)/t13?,15-,16?,17?,18?/m1/s1 |
| InChIKey | OEVZIPQBMFPAOJ-CGQHATLRSA-N |
| XLogP | 2.21 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|