C18H23F3N4O3 — CID 139425090
N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-4-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide (PubChem CID 139425090) has the molecular formula C18H23F3N4O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-4-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide.
| Compound Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-4-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 139425090 |
| Molecular Formula | C18H23F3N4O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-4-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
| SMILES | CCC1NC(c2ccc3c(c2)CC[C@H]3NC(=O)C2OCNC2C(F)(F)F)NO1 |
| InChI | InChI=1S/C18H23F3N4O3/c1-2-13-24-16(25-28-13)10-3-5-11-9(7-10)4-6-12(11)23-17(26)14-15(18(19,20)21)22-8-27-14/h3,5,7,12-16,22,24-25H,2,4,6,8H2,1H3,(H,23,26)/t12-,13?,14?,15?,16?/m1/s1 |
| InChIKey | CCQHFPJBJSUZRR-DYCFOQDWSA-N |
| XLogP | 1.53 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |