C30H44N4O3 — CID 155296577
1-ethyl-N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-oxopyridine-3-carboxamide (PubChem CID 155296577) has the molecular formula C30H44N4O3 and a molecular weight of 508.71 g/mol. Its IUPAC name is 1-ethyl-N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-oxopyridine-3-carboxamide.
| Compound Name | 1-ethyl-N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 155296577 |
| Molecular Formula | C30H44N4O3 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 1-ethyl-N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-oxopyridine-3-carboxamide |
| SMILES | CCCCCCCCCN1OC(CC)NC1c1ccc2c(c1)CC[C@H]2NC(=O)c1ccc(=O)n(CC)c1 |
| InChI | InChI=1S/C30H44N4O3/c1-4-7-8-9-10-11-12-19-34-29(32-27(5-2)37-34)23-13-16-25-22(20-23)14-17-26(25)31-30(36)24-15-18-28(35)33(6-3)21-24/h13,15-16,18,20-21,26-27,29,32H,4-12,14,17,19H2,1-3H3,(H,31,36)/t26-,27?,29?/m1/s1 |
| InChIKey | LCJHEKODGQRQNN-JTENNJLISA-N |
| XLogP | 5.61 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|