C37H63N5O2 — CID 155296643
N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-3-methyl-1,2-diazaspiro[5.9]pentadecane-5-carboxamide (PubChem CID 155296643) has the molecular formula C37H63N5O2 and a molecular weight of 609.94 g/mol. Its IUPAC name is N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-3-methyl-1,2-diazaspiro[5.9]pentadecane-5-carboxamide.
| Compound Name | N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-3-methyl-1,2-diazaspiro[5.9]pentadecane-5-carboxamide |
|---|---|
| PubChem CID | 155296643 |
| Molecular Formula | C37H63N5O2 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 609.50 |
| IUPAC Name | N-[(1R)-5-(5-ethyl-2-nonyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-3-methyl-1,2-diazaspiro[5.9]pentadecane-5-carboxamide |
| SMILES | CCCCCCCCCN1OC(CC)NC1c1ccc2c(c1)CC[C@H]2NC(=O)C1CC(C)NNC12CCCCCCCCC2 |
| InChI | InChI=1S/C37H63N5O2/c1-4-6-7-8-12-15-18-25-42-35(39-34(5-2)44-42)30-19-21-31-29(27-30)20-22-33(31)38-36(43)32-26-28(3)40-41-37(32)23-16-13-10-9-11-14-17-24-37/h19,21,27-28,32-35,39-41H,4-18,20,22-26H2,1-3H3,(H,38,43)/t28?,32?,33-,34?,35?/m1/s1 |
| InChIKey | BOKTULATFVBDCC-NWFHPLAISA-N |
| XLogP | 7.88 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|