C17H25N5O2S — CID 155296563
N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-5-methyl-1,3,4-thiadiazolidine-2-carboxamide (PubChem CID 155296563) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-5-methyl-1,3,4-thiadiazolidine-2-carboxamide.
| Compound Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-5-methyl-1,3,4-thiadiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 155296563 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3-dihydro-1H-inden-1-yl]-5-methyl-1,3,4-thiadiazolidine-2-carboxamide |
| SMILES | CCC1NC(c2ccc3c(c2)CC[C@H]3NC(=O)C2NNC(C)S2)NO1 |
| InChI | InChI=1S/C17H25N5O2S/c1-3-14-19-15(22-24-14)11-4-6-12-10(8-11)5-7-13(12)18-16(23)17-21-20-9(2)25-17/h4,6,8-9,13-15,17,19-22H,3,5,7H2,1-2H3,(H,18,23)/t9?,13-,14?,15?,17?/m1/s1 |
| InChIKey | UHMFZSRHNUAKRT-HKECOMKXSA-N |
| XLogP | 1.16 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |