C22H36O2 — CID 139430795
(E)-1-[(8aS)-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-2,3,4-trimethylpent-2-en-1-one (PubChem CID 139430795) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (E)-1-[(8aS)-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-2,3,4-trimethylpent-2-en-1-one.
| Compound Name | (E)-1-[(8aS)-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-2,3,4-trimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 139430795 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (E)-1-[(8aS)-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-2,3,4-trimethylpent-2-en-1-one |
| SMILES | CC1=C(C(=O)/C(C)=C(\C)C(C)C)[C@@]2(C)CCCC(C)(C)C2C(O)C1 |
| InChI | InChI=1S/C22H36O2/c1-13(2)15(4)16(5)19(24)18-14(3)12-17(23)20-21(6,7)10-9-11-22(18,20)8/h13,17,20,23H,9-12H2,1-8H3/b16-15+/t17?,20?,22-/m1/s1 |
| InChIKey | MACWRYMYTISCGO-QDRHEGGNSA-N |
| XLogP | 5.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|