C16H28O2 — CID 163124840
4-(methoxymethyl)-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-ol (PubChem CID 163124840) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-(methoxymethyl)-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-ol.
| Compound Name | 4-(methoxymethyl)-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 163124840 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 4-(methoxymethyl)-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-ol |
| SMILES | COCC1=C(C)CC(O)C2C(C)(C)CCCC12C |
| InChI | InChI=1S/C16H28O2/c1-11-9-13(17)14-15(2,3)7-6-8-16(14,4)12(11)10-18-5/h13-14,17H,6-10H2,1-5H3 |
| InChIKey | CXAGZCGKJCZWFW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|