C30H42O4 — CID 139430804
(1R,3R,4S)-4-[2-[(1R,4aR)-7-hydroxy-1,4a,8-trimethyl-6-oxo-3,4-dihydro-2H-phenanthren-1-yl]ethyl]-3-ethyl-1,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 139430804) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is (1R,3R,4S)-4-[2-[(1R,4aR)-7-hydroxy-1,4a,8-trimethyl-6-oxo-3,4-dihydro-2H-phenanthren-1-yl]ethyl]-3-ethyl-1,4-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4S)-4-[2-[(1R,4aR)-7-hydroxy-1,4a,8-trimethyl-6-oxo-3,4-dihydro-2H-phenanthren-1-yl]ethyl]-3-ethyl-1,4-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 139430804 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (1R,3R,4S)-4-[2-[(1R,4aR)-7-hydroxy-1,4a,8-trimethyl-6-oxo-3,4-dihydro-2H-phenanthren-1-yl]ethyl]-3-ethyl-1,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CC[C@@H]1C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@@]1(C)CCC[C@@]2(C)C3=CC(=O)C(O)=C(C)C3=CC=C12 |
| InChI | InChI=1S/C30H42O4/c1-7-20-18-29(5,26(33)34)16-14-27(20,3)13-15-28(4)11-8-12-30(6)22-17-23(31)25(32)19(2)21(22)9-10-24(28)30/h9-10,17,20,32H,7-8,11-16,18H2,1-6H3,(H,33,34)/t20-,27+,28-,29-,30+/m1/s1 |
| InChIKey | BMXIQXUSVYORMD-PFOLDSGOSA-N |
| XLogP | 7.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |