C17H12F2N2O3 — CID 139434474
methyl 4-[2-(2,6-difluoroanilino)-1,3-oxazol-5-yl]benzoate (PubChem CID 139434474) has the molecular formula C17H12F2N2O3 and a molecular weight of 330.29 g/mol. Its IUPAC name is methyl 4-[2-(2,6-difluoroanilino)-1,3-oxazol-5-yl]benzoate.
| Compound Name | methyl 4-[2-(2,6-difluoroanilino)-1,3-oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 139434474 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | methyl 4-[2-(2,6-difluoroanilino)-1,3-oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cnc(Nc3c(F)cccc3F)o2)cc1 |
| InChI | InChI=1S/C17H12F2N2O3/c1-23-16(22)11-7-5-10(6-8-11)14-9-20-17(24-14)21-15-12(18)3-2-4-13(15)19/h2-9H,1H3,(H,20,21) |
| InChIKey | GZPPGMMHBWFCBB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |