C24H24ClN5O3 — CID 139437950
7-(5-chloro-2,3-dihydroindole-1-carbonyl)-4-(cyclobutanecarboximidoyl)-3-imino-6-(methoxymethyl)-1H-quinoxalin-2-one (PubChem CID 139437950) has the molecular formula C24H24ClN5O3 and a molecular weight of 465.94 g/mol. Its IUPAC name is 7-(5-chloro-2,3-dihydroindole-1-carbonyl)-4-(cyclobutanecarboximidoyl)-3-imino-6-(methoxymethyl)-1H-quinoxalin-2-one.
| Compound Name | 7-(5-chloro-2,3-dihydroindole-1-carbonyl)-4-(cyclobutanecarboximidoyl)-3-imino-6-(methoxymethyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 139437950 |
| Molecular Formula | C24H24ClN5O3 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 7-(5-chloro-2,3-dihydroindole-1-carbonyl)-4-(cyclobutanecarboximidoyl)-3-imino-6-(methoxymethyl)-1H-quinoxalin-2-one |
| SMILES | [H]/N=C(\C1CCC1)n1/c(=N/[H])c(=O)[nH]c2cc(C(=O)N3CCc4cc(Cl)ccc43)c(COC)cc21 |
| InChI | InChI=1S/C24H24ClN5O3/c1-33-12-15-10-20-18(28-23(31)22(27)30(20)21(26)13-3-2-4-13)11-17(15)24(32)29-8-7-14-9-16(25)5-6-19(14)29/h5-6,9-11,13,26-27H,2-4,7-8,12H2,1H3,(H,28,31)/b26-21+,27-22+ |
| InChIKey | MTJDRHOPIUPARB-ZVKGZHONSA-N |
| XLogP | 3.44 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|