C9H18N2O2 — CID 139444164
2-cycloheptyl-1,2,4-oxadiazolidin-5-ol (PubChem CID 139444164) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-cycloheptyl-1,2,4-oxadiazolidin-5-ol.
| Compound Name | 2-cycloheptyl-1,2,4-oxadiazolidin-5-ol |
|---|---|
| PubChem CID | 139444164 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-cycloheptyl-1,2,4-oxadiazolidin-5-ol |
| SMILES | OC1NCN(C2CCCCCC2)O1 |
| InChI | InChI=1S/C9H18N2O2/c12-9-10-7-11(13-9)8-5-3-1-2-4-6-8/h8-10,12H,1-7H2 |
| InChIKey | OJLVZGRRSQREFH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |