C17H20Cl2F3N — CID 139448885
(1S,3R,6R)-7,7-dichloro-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]bicyclo[4.2.0]octan-3-amine (PubChem CID 139448885) has the molecular formula C17H20Cl2F3N and a molecular weight of 366.25 g/mol. Its IUPAC name is (1S,3R,6R)-7,7-dichloro-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]bicyclo[4.2.0]octan-3-amine.
| Compound Name | (1S,3R,6R)-7,7-dichloro-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]bicyclo[4.2.0]octan-3-amine |
|---|---|
| PubChem CID | 139448885 |
| Molecular Formula | C17H20Cl2F3N |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (1S,3R,6R)-7,7-dichloro-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]bicyclo[4.2.0]octan-3-amine |
| SMILES | CN(C)[C@@H]1CC[C@H]2C(Cl)(Cl)C[C@@]2(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H20Cl2F3N/c1-23(2)13-6-7-14-15(9-13,10-16(14,18)19)11-4-3-5-12(8-11)17(20,21)22/h3-5,8,13-14H,6-7,9-10H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | CLEDYCXCUUHCIL-RBSFLKMASA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|