C11H21N — CID 139449270
3-ethenyl-2,5-dimethylhept-6-en-1-amine (PubChem CID 139449270) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-ethenyl-2,5-dimethylhept-6-en-1-amine.
| Compound Name | 3-ethenyl-2,5-dimethylhept-6-en-1-amine |
|---|---|
| PubChem CID | 139449270 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-ethenyl-2,5-dimethylhept-6-en-1-amine |
| SMILES | C=CC(C)CC(C=C)C(C)CN |
| InChI | InChI=1S/C11H21N/c1-5-9(3)7-11(6-2)10(4)8-12/h5-6,9-11H,1-2,7-8,12H2,3-4H3 |
| InChIKey | PXHGITUAMZFTIY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|