C20H21N3O3 — CID 139451627
N-hydroxy-4-[(3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide (PubChem CID 139451627) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-hydroxy-4-[(3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide.
| Compound Name | N-hydroxy-4-[(3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 139451627 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-hydroxy-4-[(3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccccc3C23CCNCC3)cc1 |
| InChI | InChI=1S/C20H21N3O3/c24-18(22-26)15-7-5-14(6-8-15)13-23-19(25)16-3-1-2-4-17(16)20(23)9-11-21-12-10-20/h1-8,21,26H,9-13H2,(H,22,24) |
| InChIKey | TVNPEEYFQRWGNM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|