C22H25N3O4 — CID 139460088
N-hydroxy-4-[[1'-(1-hydroxyethyl)-3-oxospiro[isoindole-1,4'-piperidine]-2-yl]methyl]benzamide (PubChem CID 139460088) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-hydroxy-4-[[1'-(1-hydroxyethyl)-3-oxospiro[isoindole-1,4'-piperidine]-2-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[1'-(1-hydroxyethyl)-3-oxospiro[isoindole-1,4'-piperidine]-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 139460088 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-hydroxy-4-[[1'-(1-hydroxyethyl)-3-oxospiro[isoindole-1,4'-piperidine]-2-yl]methyl]benzamide |
| SMILES | CC(O)N1CCC2(CC1)c1ccccc1C(=O)N2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-15(26)24-12-10-22(11-13-24)19-5-3-2-4-18(19)21(28)25(22)14-16-6-8-17(9-7-16)20(27)23-29/h2-9,15,26,29H,10-14H2,1H3,(H,23,27) |
| InChIKey | KXWBZFFJLCVTOP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|