About N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide
N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide (PubChem CID 162647611) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide |
| PubChem CID | 162647611 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide |
| SMILES | CN1CC2(CCN(Cc3ccc(C(=O)NO)cc3)CC2)c2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C27H29N3O2/c1-29-19-27(24-9-5-8-23(25(24)29)21-6-3-2-4-7-21)14-16-30(17-15-27)18-20-10-12-22(13-11-20)26(31)28-32/h2-13,32H,14-19H2,1H3,(H,28,31) |
| InChIKey | LDWBAEGQYZGDNJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide?
The IUPAC name of N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide (CID 162647611) is N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide.
What is the SMILES notation for N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide?
The canonical SMILES for N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide is CN1CC2(CCN(Cc3ccc(C(=O)NO)cc3)CC2)c2cccc(-c3ccccc3)c21.
What is the InChIKey of N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide?
The InChIKey is LDWBAEGQYZGDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O2/c1-29-19-27(24-9-5-8-23(25(24)29)21-6-3-2-4-7-21)14-16-30(17-15-27)18-20-10-12-22(13-11-20)26(31)28-32/h2-13,32H,14-19H2,1H3,(H,28,31).
What are the key properties of N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide?
N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide has a molecular weight of 427.55 g/mol, XLogP of 4.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-[(1-methyl-7-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]benzamide is sourced from PubChem (CID 162647611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).