C36H58N7O6P — CID 139454185
[4-[(2S)-2-amino-3-[[(Z)-octadec-9-enyl]amino]-3-oxopropyl]phenoxy]-[[(2S)-1-(6-aminopurin-9-yl)-3-hydroxypropan-2-yl]oxymethyl]phosphinic acid (PubChem CID 139454185) has the molecular formula C36H58N7O6P and a molecular weight of 715.88 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-[[(Z)-octadec-9-enyl]amino]-3-oxopropyl]phenoxy]-[[(2S)-1-(6-aminopurin-9-yl)-3-hydroxypropan-2-yl]oxymethyl]phosphinic acid.
| Compound Name | [4-[(2S)-2-amino-3-[[(Z)-octadec-9-enyl]amino]-3-oxopropyl]phenoxy]-[[(2S)-1-(6-aminopurin-9-yl)-3-hydroxypropan-2-yl]oxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 139454185 |
| Molecular Formula | C36H58N7O6P |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 715.42 |
| IUPAC Name | [4-[(2S)-2-amino-3-[[(Z)-octadec-9-enyl]amino]-3-oxopropyl]phenoxy]-[[(2S)-1-(6-aminopurin-9-yl)-3-hydroxypropan-2-yl]oxymethyl]phosphinic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)[C@@H](N)Cc1ccc(OP(=O)(O)CO[C@H](CO)Cn2cnc3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C36H58N7O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-39-36(45)32(37)23-29-18-20-30(21-19-29)49-50(46,47)28-48-31(25-44)24-43-27-42-33-34(38)40-26-41-35(33)43/h9-10,18-21,26-27,31-32,44H,2-8,11-17,22-25,28,37H2,1H3,(H,39,45)(H,46,47)(H2,38,40,41)/b10-9-/t31-,32-/m0/s1 |
| InChIKey | BHZBMENCPPDLDK-YWUGPAMUSA-N |
| XLogP | 6.03 |
| TPSA | 200.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|