C24H26ClN5O2 — CID 139455246
N-(5-chloro-1-methyl-2H-pyridin-2-yl)-2-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-5-methylbenzamide (PubChem CID 139455246) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-(5-chloro-1-methyl-2H-pyridin-2-yl)-2-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-5-methylbenzamide.
| Compound Name | N-(5-chloro-1-methyl-2H-pyridin-2-yl)-2-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-5-methylbenzamide |
|---|---|
| PubChem CID | 139455246 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-(5-chloro-1-methyl-2H-pyridin-2-yl)-2-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-5-methylbenzamide |
| SMILES | [H]/N=C(\C)N(C)c1ccc(C(=O)Nc2ccc(C)cc2C(=O)NC2C=CC(Cl)=CN2C)cc1 |
| InChI | InChI=1S/C24H26ClN5O2/c1-15-5-11-21(20(13-15)24(32)28-22-12-8-18(25)14-29(22)3)27-23(31)17-6-9-19(10-7-17)30(4)16(2)26/h5-14,22,26H,1-4H3,(H,27,31)(H,28,32)/b26-16+ |
| InChIKey | GPBKMZOXWDVPLX-WGOQTCKBSA-N |
| XLogP | 4.32 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|