C23H22ClN5O3 — CID 139340680
N-(5-chloro-2-pyridinyl)-6-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-2-hydroxy-3-methylbenzamide (PubChem CID 139340680) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-6-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-2-hydroxy-3-methylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-6-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-2-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 139340680 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-6-[[4-[ethanimidoyl(methyl)amino]benzoyl]amino]-2-hydroxy-3-methylbenzamide |
| SMILES | [H]/N=C(\C)N(C)c1ccc(C(=O)Nc2ccc(C)c(O)c2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C23H22ClN5O3/c1-13-4-10-18(20(21(13)30)23(32)28-19-11-7-16(24)12-26-19)27-22(31)15-5-8-17(9-6-15)29(3)14(2)25/h4-12,25,30H,1-3H3,(H,27,31)(H,26,28,32)/b25-14+ |
| InChIKey | CMUMUPVXCZLXLL-AFUMVMLFSA-N |
| XLogP | 4.69 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|