C13H16N6O — CID 139458342
(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(2H-triazolo[4,5-b]pyridin-5-yl)methanone (PubChem CID 139458342) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(2H-triazolo[4,5-b]pyridin-5-yl)methanone.
| Compound Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(2H-triazolo[4,5-b]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 139458342 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(2H-triazolo[4,5-b]pyridin-5-yl)methanone |
| SMILES | CN1CC2CN(C(=O)c3ccc4n[nH]nc4n3)CC2C1 |
| InChI | InChI=1S/C13H16N6O/c1-18-4-8-6-19(7-9(8)5-18)13(20)11-3-2-10-12(14-11)16-17-15-10/h2-3,8-9H,4-7H2,1H3,(H,14,15,16,17) |
| InChIKey | LRJASPKWZUPCOZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |