About methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate
methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate (PubChem CID 139460504) has the molecular formula C20H19NO4
and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate |
| PubChem CID | 139460504 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C3(CCOC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-24-18(22)15-8-6-14(7-9-15)12-21-17-5-3-2-4-16(17)20(19(21)23)10-11-25-13-20/h2-9H,10-13H2,1H3 |
| InChIKey | HMARDUXFAYXLPK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate?
The IUPAC name of methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate (CID 139460504) is methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate?
The canonical SMILES for methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate is COC(=O)c1ccc(CN2C(=O)C3(CCOC3)c3ccccc32)cc1.
What is the InChIKey of methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate?
The InChIKey is HMARDUXFAYXLPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c1-24-18(22)15-8-6-14(7-9-15)12-21-17-5-3-2-4-16(17)20(19(21)23)10-11-25-13-20/h2-9H,10-13H2,1H3.
What are the key properties of methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate?
methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate has a molecular weight of 337.38 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-oxospiro[indole-3,3'-oxolane]-1-yl)methyl]benzoate is sourced from PubChem (CID 139460504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).