C28H26N2O6 — CID 71490416
dimethyl 1-benzyl-2-oxo-2'-phenylspiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate (PubChem CID 71490416) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is dimethyl 1-benzyl-2-oxo-2'-phenylspiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-2-oxo-2'-phenylspiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate |
|---|---|
| PubChem CID | 71490416 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | dimethyl 1-benzyl-2-oxo-2'-phenylspiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCON(c2ccccc2)C12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C28H26N2O6/c1-34-25(32)27(26(33)35-2)17-18-36-30(21-13-7-4-8-14-21)28(27)22-15-9-10-16-23(22)29(24(28)31)19-20-11-5-3-6-12-20/h3-16H,17-19H2,1-2H3 |
| InChIKey | CJTAPSWENCSMCR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|