C13H10ClFN4O7S — CID 139461505
2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethyl methanesulfonate (PubChem CID 139461505) has the molecular formula C13H10ClFN4O7S and a molecular weight of 420.76 g/mol. Its IUPAC name is 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethyl methanesulfonate.
| Compound Name | 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139461505 |
| Molecular Formula | C13H10ClFN4O7S |
| Molecular Weight | 420.76 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClFN4O7S/c1-27(21,22)24-5-4-23-12-10(16-26-18-12)11-17-25-13(20)19(11)7-2-3-9(15)8(14)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | JFDIRVWRMXDYER-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 139.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.76 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|