C21H20F9NO5S — CID 139461787
methyl 1-[[5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate (PubChem CID 139461787) has the molecular formula C21H20F9NO5S and a molecular weight of 569.44 g/mol. Its IUPAC name is methyl 1-[[5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[[5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139461787 |
| Molecular Formula | C21H20F9NO5S |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | methyl 1-[[5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(CN2CC3(Cc4ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc4C3)C2)CC1 |
| InChI | InChI=1S/C21H20F9NO5S/c1-35-15(32)17(4-5-17)11-31-9-16(10-31)7-12-2-3-14(6-13(12)8-16)36-37(33,34)21(29,30)19(24,25)18(22,23)20(26,27)28/h2-3,6H,4-5,7-11H2,1H3 |
| InChIKey | RIUWUEIKTUZCRF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|