C26H20FN3O3S — CID 139465038
3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indole-6-carboxamide (PubChem CID 139465038) has the molecular formula C26H20FN3O3S and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indole-6-carboxamide.
| Compound Name | 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indole-6-carboxamide |
|---|---|
| PubChem CID | 139465038 |
| Molecular Formula | C26H20FN3O3S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indole-6-carboxamide |
| SMILES | N#Cc1cccc(-c2cn(-c3ccc(F)cc3)c3cc(C(=O)NC4CCS(=O)(=O)C4)ccc23)c1 |
| InChI | InChI=1S/C26H20FN3O3S/c27-20-5-7-22(8-6-20)30-15-24(18-3-1-2-17(12-18)14-28)23-9-4-19(13-25(23)30)26(31)29-21-10-11-34(32,33)16-21/h1-9,12-13,15,21H,10-11,16H2,(H,29,31) |
| InChIKey | SOUKPXSZZXZTDI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |