C40H53N3O7S2 — CID 139465587
2-[tert-butyl-[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid (PubChem CID 139465587) has the molecular formula C40H53N3O7S2 and a molecular weight of 752.01 g/mol. Its IUPAC name is 2-[tert-butyl-[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 139465587 |
| Molecular Formula | C40H53N3O7S2 |
| Molecular Weight | 752.01 g/mol |
| Exact Mass | 751.33 |
| IUPAC Name | 2-[tert-butyl-[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)N(CC(=O)O)C(C)(C)C)c3ccccc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C40H53N3O7S2/c1-7-9-21-40(22-10-8-2)27-42(30-19-15-12-16-20-30)31-23-33(51-6)32(24-34(31)52(48,49)28-40)50-26-35(44)41-37(29-17-13-11-14-18-29)38(47)43(25-36(45)46)39(3,4)5/h11-20,23-24,37H,7-10,21-22,25-28H2,1-6H3,(H,41,44)(H,45,46)/t37-/m1/s1 |
| InChIKey | VGLHLMKASFBEKH-DIPNUNPCSA-N |
| XLogP | 7.65 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.01 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |