C38H48N2O8S2 — CID 148552954
(2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-5-(4-hydroxyphenyl)-2-methyl-4-oxopentanoic acid (PubChem CID 148552954) has the molecular formula C38H48N2O8S2 and a molecular weight of 724.94 g/mol. Its IUPAC name is (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-5-(4-hydroxyphenyl)-2-methyl-4-oxopentanoic acid.
| Compound Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-5-(4-hydroxyphenyl)-2-methyl-4-oxopentanoic acid |
|---|---|
| PubChem CID | 148552954 |
| Molecular Formula | C38H48N2O8S2 |
| Molecular Weight | 724.94 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-5-(4-hydroxyphenyl)-2-methyl-4-oxopentanoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)C[C@@H](C)C(=O)O)c3ccc(O)cc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C38H48N2O8S2/c1-5-7-18-38(19-8-6-2)24-40(28-12-10-9-11-13-28)30-21-33(49-4)32(22-34(30)50(46,47)25-38)48-23-35(43)39-36(27-14-16-29(41)17-15-27)31(42)20-26(3)37(44)45/h9-17,21-22,26,36,41H,5-8,18-20,23-25H2,1-4H3,(H,39,43)(H,44,45)/t26-,36-/m1/s1 |
| InChIKey | MTNAAKBWIMSBOE-SXZDHJFLSA-N |
| XLogP | 7.32 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.94 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |