C39H50N2O7S2 — CID 148606593
(2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-4-oxo-5-phenylpentanoic acid (PubChem CID 148606593) has the molecular formula C39H50N2O7S2 and a molecular weight of 722.97 g/mol. Its IUPAC name is (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-4-oxo-5-phenylpentanoic acid.
| Compound Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-4-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 148606593 |
| Molecular Formula | C39H50N2O7S2 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-4-oxo-5-phenylpentanoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)C[C@@H](CC)C(=O)O)c3ccccc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C39H50N2O7S2/c1-5-8-20-39(21-9-6-2)26-41(30-18-14-11-15-19-30)31-23-34(49-4)33(24-35(31)50(46,47)27-39)48-25-36(43)40-37(29-16-12-10-13-17-29)32(42)22-28(7-3)38(44)45/h10-19,23-24,28,37H,5-9,20-22,25-27H2,1-4H3,(H,40,43)(H,44,45)/t28-,37-/m1/s1 |
| InChIKey | NDNSQFQFCMLYRA-KWXDVARASA-N |
| XLogP | 8.01 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |