C39H50N2O8S2 — CID 147975074
(2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-5-(4-hydroxyphenyl)-4-oxopentanoic acid (PubChem CID 147975074) has the molecular formula C39H50N2O8S2 and a molecular weight of 738.97 g/mol. Its IUPAC name is (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-5-(4-hydroxyphenyl)-4-oxopentanoic acid.
| Compound Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-5-(4-hydroxyphenyl)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 147975074 |
| Molecular Formula | C39H50N2O8S2 |
| Molecular Weight | 738.97 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | (2R,5R)-5-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-ethyl-5-(4-hydroxyphenyl)-4-oxopentanoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)CC(CC)C(=O)O)c3ccc(O)cc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C39H50N2O8S2/c1-5-8-19-39(20-9-6-2)25-41(29-13-11-10-12-14-29)31-22-34(50-4)33(23-35(31)51(47,48)26-39)49-24-36(44)40-37(28-15-17-30(42)18-16-28)32(43)21-27(7-3)38(45)46/h10-18,22-23,27,37,42H,5-9,19-21,24-26H2,1-4H3,(H,40,44)(H,45,46)/t27?,37-/m1/s1 |
| InChIKey | ISCUSXJARVWRSF-XAPWFUBHSA-N |
| XLogP | 7.71 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.97 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |