C37H48N3O8S3- — CID 58821164
2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]-methylamino]ethanesulfonate (PubChem CID 58821164) has the molecular formula C37H48N3O8S3- and a molecular weight of 759.01 g/mol. Its IUPAC name is 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]-methylamino]ethanesulfonate.
| Compound Name | 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]-methylamino]ethanesulfonate |
|---|---|
| PubChem CID | 58821164 |
| Molecular Formula | C37H48N3O8S3- |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.26 |
| IUPAC Name | 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]-methylamino]ethanesulfonate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)N(C)CCS(=O)(=O)[O-])c3ccccc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C37H49N3O8S3/c1-5-7-19-37(20-8-6-2)26-40(29-17-13-10-14-18-29)30-23-32(49-4)31(24-33(30)50(43,44)27-37)48-25-34(41)38-35(28-15-11-9-12-16-28)36(42)39(3)21-22-51(45,46)47/h9-18,23-24,35H,5-8,19-22,25-27H2,1-4H3,(H,38,41)(H,45,46,47)/p-1/t35-/m1/s1 |
| InChIKey | FMZPJMFDNFAZAN-PGUFJCEWSA-M |
| XLogP | 5.94 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|