C22H21FN2O5S — CID 139483510
N-[cyclopropyl-[3-(cyclopropylmethoxy)-4-fluorophenyl]methyl]-1,3-dioxoisoindole-2-sulfonamide (PubChem CID 139483510) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[cyclopropyl-[3-(cyclopropylmethoxy)-4-fluorophenyl]methyl]-1,3-dioxoisoindole-2-sulfonamide.
| Compound Name | N-[cyclopropyl-[3-(cyclopropylmethoxy)-4-fluorophenyl]methyl]-1,3-dioxoisoindole-2-sulfonamide |
|---|---|
| PubChem CID | 139483510 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[cyclopropyl-[3-(cyclopropylmethoxy)-4-fluorophenyl]methyl]-1,3-dioxoisoindole-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1S(=O)(=O)NC(c1ccc(F)c(OCC2CC2)c1)C1CC1 |
| InChI | InChI=1S/C22H21FN2O5S/c23-18-10-9-15(11-19(18)30-12-13-5-6-13)20(14-7-8-14)24-31(28,29)25-21(26)16-3-1-2-4-17(16)22(25)27/h1-4,9-11,13-14,20,24H,5-8,12H2 |
| InChIKey | KZNIPGKFTYIOQA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|