C26H21NS — CID 139484211
(3E,5E)-5-dibenzothiophen-2-yl-7-phenylocta-1,3,5,7-tetraen-3-amine (PubChem CID 139484211) has the molecular formula C26H21NS and a molecular weight of 379.53 g/mol. Its IUPAC name is (3E,5E)-5-dibenzothiophen-2-yl-7-phenylocta-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E)-5-dibenzothiophen-2-yl-7-phenylocta-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 139484211 |
| Molecular Formula | C26H21NS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (3E,5E)-5-dibenzothiophen-2-yl-7-phenylocta-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C(N)=C\C(=C/C(=C)c1ccccc1)c1ccc2sc3ccccc3c2c1 |
| InChI | InChI=1S/C26H21NS/c1-3-22(27)16-21(15-18(2)19-9-5-4-6-10-19)20-13-14-26-24(17-20)23-11-7-8-12-25(23)28-26/h3-17H,1-2,27H2/b21-15+,22-16+ |
| InChIKey | KUTGWYBRUSKAGQ-YHARCJFQSA-N |
| XLogP | 7.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|