About N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine
N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine (PubChem CID 139491783) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine |
| PubChem CID | 139491783 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine |
| SMILES | CCNCN(C)CC(C)C=CC(CC)CC |
| InChI | InChI=1S/C14H30N2/c1-6-14(7-2)10-9-13(4)11-16(5)12-15-8-3/h9-10,13-15H,6-8,11-12H2,1-5H3 |
| InChIKey | IPYAWVIWYYYOGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine?
The IUPAC name of N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine (CID 139491783) is N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine.
What is the SMILES notation for N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine?
The canonical SMILES for N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine is CCNCN(C)CC(C)C=CC(CC)CC.
What is the InChIKey of N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine?
The InChIKey is IPYAWVIWYYYOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-6-14(7-2)10-9-13(4)11-16(5)12-15-8-3/h9-10,13-15H,6-8,11-12H2,1-5H3.
What are the key properties of N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine?
N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine has a molecular weight of 226.41 g/mol, XLogP of 3.11, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(5-ethyl-2-methylhept-3-enyl)-N'-methylmethanediamine is sourced from PubChem (CID 139491783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).