C15H32N2 — CID 129302701
N',N'-dimethyl-N-[(6R)-2,5,6-trimethylnon-4-en-3-yl]methanediamine (PubChem CID 129302701) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(6R)-2,5,6-trimethylnon-4-en-3-yl]methanediamine.
| Compound Name | N',N'-dimethyl-N-[(6R)-2,5,6-trimethylnon-4-en-3-yl]methanediamine |
|---|---|
| PubChem CID | 129302701 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N',N'-dimethyl-N-[(6R)-2,5,6-trimethylnon-4-en-3-yl]methanediamine |
| SMILES | CCC[C@@H](C)C(C)=CC(NCN(C)C)C(C)C |
| InChI | InChI=1S/C15H32N2/c1-8-9-13(4)14(5)10-15(12(2)3)16-11-17(6)7/h10,12-13,15-16H,8-9,11H2,1-7H3/t13-,15?/m1/s1 |
| InChIKey | LIEKMOIJIIQEKL-AFYYWNPRSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|