C17H36N2 — CID 176921676
(Z)-1-N,3-dimethyl-1-N'-(3-methylpentyl)-1-N'-propylhex-2-ene-1,1-diamine (PubChem CID 176921676) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is (Z)-1-N,3-dimethyl-1-N'-(3-methylpentyl)-1-N'-propylhex-2-ene-1,1-diamine.
| Compound Name | (Z)-1-N,3-dimethyl-1-N'-(3-methylpentyl)-1-N'-propylhex-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 176921676 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | (Z)-1-N,3-dimethyl-1-N'-(3-methylpentyl)-1-N'-propylhex-2-ene-1,1-diamine |
| SMILES | CCC/C(C)=C\C(NC)N(CCC)CCC(C)CC |
| InChI | InChI=1S/C17H36N2/c1-7-10-16(5)14-17(18-6)19(12-8-2)13-11-15(4)9-3/h14-15,17-18H,7-13H2,1-6H3/b16-14- |
| InChIKey | RNJSCSHFSUGYQV-PEZBUJJGSA-N |
| XLogP | 4.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|