About N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide
N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide (PubChem CID 139493453) has the molecular formula C23H48N2O
and a molecular weight of 368.65 g/mol. Its IUPAC name is N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide.
Molecular Properties
| Compound Name | N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide |
| PubChem CID | 139493453 |
| Molecular Formula | C23H48N2O |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.38 |
| IUPAC Name | N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide |
| SMILES | CC(C)CN(C(C)C)C(C)CCC(C)(C)C(=O)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H48N2O/c1-17(2)16-24(18(3)4)19(5)14-15-23(12,13)20(26)25(21(6,7)8)22(9,10)11/h17-19H,14-16H2,1-13H3 |
| InChIKey | QWHKNJBOUDHTEZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide?
The IUPAC name of N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide (CID 139493453) is N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide.
What is the SMILES notation for N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide?
The canonical SMILES for N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide is CC(C)CN(C(C)C)C(C)CCC(C)(C)C(=O)N(C(C)(C)C)C(C)(C)C.
What is the InChIKey of N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide?
The InChIKey is QWHKNJBOUDHTEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48N2O/c1-17(2)16-24(18(3)4)19(5)14-15-23(12,13)20(26)25(21(6,7)8)22(9,10)11/h17-19H,14-16H2,1-13H3.
What are the key properties of N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide?
N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide has a molecular weight of 368.65 g/mol, XLogP of 5.97, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-ditert-butyl-2,2-dimethyl-5-[2-methylpropyl(propan-2-yl)amino]hexanamide is sourced from PubChem (CID 139493453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).