C22H27FN8O11P2S — CID 139493662
[(1S,2R,3S,5R)-3-dihydroxyphosphinothioyloxy-2-hydroxy-5-(1-methyl-6-oxopurin-9-yl)cyclopentyl] [(2S,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 139493662) has the molecular formula C22H27FN8O11P2S and a molecular weight of 692.52 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-3-dihydroxyphosphinothioyloxy-2-hydroxy-5-(1-methyl-6-oxopurin-9-yl)cyclopentyl] [(2S,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(1S,2R,3S,5R)-3-dihydroxyphosphinothioyloxy-2-hydroxy-5-(1-methyl-6-oxopurin-9-yl)cyclopentyl] [(2S,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 139493662 |
| Molecular Formula | C22H27FN8O11P2S |
| Molecular Weight | 692.52 g/mol |
| Exact Mass | 692.10 |
| IUPAC Name | [(1S,2R,3S,5R)-3-dihydroxyphosphinothioyloxy-2-hydroxy-5-(1-methyl-6-oxopurin-9-yl)cyclopentyl] [(2S,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Cn1cnc2c(ncn2[C@@H]2C[C@H](OP(O)(O)=S)[C@@H](O)[C@H]2OP(=O)(O)OC[C@@H]2C[C@@H](F)[C@H](n3cnc4c(=O)n(C)cnc43)O2)c1=O |
| InChI | InChI=1S/C22H27FN8O11P2S/c1-28-6-26-18-14(20(28)33)24-8-30(18)12-4-13(41-44(37,38)45)16(32)17(12)42-43(35,36)39-5-10-3-11(23)22(40-10)31-9-25-15-19(31)27-7-29(2)21(15)34/h6-13,16-17,22,32H,3-5H2,1-2H3,(H,35,36)(H2,37,38,45)/t10-,11+,12+,13-,16+,17-,22+/m0/s1 |
| InChIKey | FMKQTSFNSXBYAA-ACPLBCQNSA-N |
| XLogP | -0.70 |
| TPSA | 240.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.52 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|