C22H27FN8O12P2 — CID 166676834
[(2R,3R,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] [(1S,2S,4S)-2-hydroxy-4-(1-methyl-6-oxopurin-9-yl)cyclopentyl] hydrogen phosphate (PubChem CID 166676834) has the molecular formula C22H27FN8O12P2 and a molecular weight of 676.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] [(1S,2S,4S)-2-hydroxy-4-(1-methyl-6-oxopurin-9-yl)cyclopentyl] hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] [(1S,2S,4S)-2-hydroxy-4-(1-methyl-6-oxopurin-9-yl)cyclopentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 166676834 |
| Molecular Formula | C22H27FN8O12P2 |
| Molecular Weight | 676.45 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | [(2R,3R,4R,5R)-4-fluoro-5-(1-methyl-6-oxopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] [(1S,2S,4S)-2-hydroxy-4-(1-methyl-6-oxopurin-9-yl)cyclopentyl] hydrogen phosphate |
| SMILES | Cn1cnc2c(ncn2[C@@H]2C[C@H](OP(=O)(O)O[C@H]3[C@@H](F)[C@H](n4cnc5c(=O)n(C)cnc54)O[C@@H]3COP(=O)(O)O)[C@@H](O)C2)c1=O |
| InChI | InChI=1S/C22H27FN8O12P2/c1-28-6-26-18-15(20(28)33)24-8-30(18)10-3-11(32)12(4-10)42-45(38,39)43-17-13(5-40-44(35,36)37)41-22(14(17)23)31-9-25-16-19(31)27-7-29(2)21(16)34/h6-14,17,22,32H,3-5H2,1-2H3,(H,38,39)(H2,35,36,37)/t10-,11-,12-,13+,14+,17+,22+/m0/s1 |
| InChIKey | YDIQSXABEFZZDG-UHWBHDAYSA-N |
| XLogP | -0.81 |
| TPSA | 257.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.45 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|