C29H32N2O5 — CID 139499724
[4-(4-methoxybenzoyl)-2-[methyl(6-phenylhexylcarbamoyl)amino]phenyl] formate (PubChem CID 139499724) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is [4-(4-methoxybenzoyl)-2-[methyl(6-phenylhexylcarbamoyl)amino]phenyl] formate.
| Compound Name | [4-(4-methoxybenzoyl)-2-[methyl(6-phenylhexylcarbamoyl)amino]phenyl] formate |
|---|---|
| PubChem CID | 139499724 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [4-(4-methoxybenzoyl)-2-[methyl(6-phenylhexylcarbamoyl)amino]phenyl] formate |
| SMILES | COc1ccc(C(=O)c2ccc(OC=O)c(N(C)C(=O)NCCCCCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H32N2O5/c1-31(29(34)30-19-9-4-3-6-10-22-11-7-5-8-12-22)26-20-24(15-18-27(26)36-21-32)28(33)23-13-16-25(35-2)17-14-23/h5,7-8,11-18,20-21H,3-4,6,9-10,19H2,1-2H3,(H,30,34) |
| InChIKey | UNUFQEMJYOXWOC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|