C28H29F3N2O3 — CID 144959452
[2-[methyl(6-phenylhexylcarbamoyl)amino]-4-[4-(trifluoromethyl)phenyl]phenyl] formate (PubChem CID 144959452) has the molecular formula C28H29F3N2O3 and a molecular weight of 498.55 g/mol. Its IUPAC name is [2-[methyl(6-phenylhexylcarbamoyl)amino]-4-[4-(trifluoromethyl)phenyl]phenyl] formate.
| Compound Name | [2-[methyl(6-phenylhexylcarbamoyl)amino]-4-[4-(trifluoromethyl)phenyl]phenyl] formate |
|---|---|
| PubChem CID | 144959452 |
| Molecular Formula | C28H29F3N2O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [2-[methyl(6-phenylhexylcarbamoyl)amino]-4-[4-(trifluoromethyl)phenyl]phenyl] formate |
| SMILES | CN(C(=O)NCCCCCCc1ccccc1)c1cc(-c2ccc(C(F)(F)F)cc2)ccc1OC=O |
| InChI | InChI=1S/C28H29F3N2O3/c1-33(27(35)32-18-8-3-2-5-9-21-10-6-4-7-11-21)25-19-23(14-17-26(25)36-20-34)22-12-15-24(16-13-22)28(29,30)31/h4,6-7,10-17,19-20H,2-3,5,8-9,18H2,1H3,(H,32,35) |
| InChIKey | FPHYQGQNSXBHFZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|