C21H26F2NO9PS — CID 139505283
[[6-[3-fluoro-4-(2-fluoro-4-methoxyphenyl)-6-oxocyclohexa-2,4-dien-1-yl]-2-methyl-2-methylsulfonylhexanoyl]amino] dihydrogen phosphate (PubChem CID 139505283) has the molecular formula C21H26F2NO9PS and a molecular weight of 537.47 g/mol. Its IUPAC name is [[6-[3-fluoro-4-(2-fluoro-4-methoxyphenyl)-6-oxocyclohexa-2,4-dien-1-yl]-2-methyl-2-methylsulfonylhexanoyl]amino] dihydrogen phosphate.
| Compound Name | [[6-[3-fluoro-4-(2-fluoro-4-methoxyphenyl)-6-oxocyclohexa-2,4-dien-1-yl]-2-methyl-2-methylsulfonylhexanoyl]amino] dihydrogen phosphate |
|---|---|
| PubChem CID | 139505283 |
| Molecular Formula | C21H26F2NO9PS |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | [[6-[3-fluoro-4-(2-fluoro-4-methoxyphenyl)-6-oxocyclohexa-2,4-dien-1-yl]-2-methyl-2-methylsulfonylhexanoyl]amino] dihydrogen phosphate |
| SMILES | COc1ccc(C2=CC(=O)C(CCCCC(C)(C(=O)NOP(=O)(O)O)S(C)(=O)=O)C=C2F)c(F)c1 |
| InChI | InChI=1S/C21H26F2NO9PS/c1-21(35(3,30)31,20(26)24-33-34(27,28)29)9-5-4-6-13-10-17(22)16(12-19(13)25)15-8-7-14(32-2)11-18(15)23/h7-8,10-13H,4-6,9H2,1-3H3,(H,24,26)(H2,27,28,29) |
| InChIKey | GTEHTFWRKFEQTD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|