C23H45N3 — CID 139514334
N'-[3-(dimethylamino)propyl]-N-ethyl-N-methyl-N'-(2-methyl-7-methylidenenona-1,8-dien-3-yl)butane-1,4-diamine (PubChem CID 139514334) has the molecular formula C23H45N3 and a molecular weight of 363.63 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N-ethyl-N-methyl-N'-(2-methyl-7-methylidenenona-1,8-dien-3-yl)butane-1,4-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl]-N-ethyl-N-methyl-N'-(2-methyl-7-methylidenenona-1,8-dien-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 139514334 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N-ethyl-N-methyl-N'-(2-methyl-7-methylidenenona-1,8-dien-3-yl)butane-1,4-diamine |
| SMILES | C=CC(=C)CCCC(C(=C)C)N(CCCCN(C)CC)CCCN(C)C |
| InChI | InChI=1S/C23H45N3/c1-9-22(5)15-13-16-23(21(3)4)26(20-14-17-24(6)7)19-12-11-18-25(8)10-2/h9,23H,1,3,5,10-20H2,2,4,6-8H3 |
| InChIKey | PBBXIXBCANIKEW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|