C16H29NO2 — CID 153293917
N,N-dimethyl-2-[2-(2-methyl-6-methylideneocta-1,7-dien-3-yl)oxyethoxy]ethanamine (PubChem CID 153293917) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(2-methyl-6-methylideneocta-1,7-dien-3-yl)oxyethoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-(2-methyl-6-methylideneocta-1,7-dien-3-yl)oxyethoxy]ethanamine |
|---|---|
| PubChem CID | 153293917 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | N,N-dimethyl-2-[2-(2-methyl-6-methylideneocta-1,7-dien-3-yl)oxyethoxy]ethanamine |
| SMILES | C=CC(=C)CCC(OCCOCCN(C)C)C(=C)C |
| InChI | InChI=1S/C16H29NO2/c1-7-15(4)8-9-16(14(2)3)19-13-12-18-11-10-17(5)6/h7,16H,1-2,4,8-13H2,3,5-6H3 |
| InChIKey | XADJNKBKCAZYBJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|