C31H36FN7O5 — CID 139514364
(2S)-2-amino-4-[[6-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-6-hydroxyhexyl]amino]-4-oxobutanoic acid (PubChem CID 139514364) has the molecular formula C31H36FN7O5 and a molecular weight of 605.67 g/mol. Its IUPAC name is (2S)-2-amino-4-[[6-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-6-hydroxyhexyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[[6-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-6-hydroxyhexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139514364 |
| Molecular Formula | C31H36FN7O5 |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | (2S)-2-amino-4-[[6-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-6-hydroxyhexyl]amino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4c3c(N)nn4C(O)CCCCCNC(=O)C[C@H](N)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C31H36FN7O5/c1-18-9-14-22(32)24(16-18)37-31(44)36-20-12-10-19(11-13-20)21-6-5-7-25-28(21)29(34)38-39(25)27(41)8-3-2-4-15-35-26(40)17-23(33)30(42)43/h5-7,9-14,16,23,27,41H,2-4,8,15,17,33H2,1H3,(H2,34,38)(H,35,40)(H,42,43)(H2,36,37,44)/t23-,27?/m0/s1 |
| InChIKey | OTLZQJFXUGMTOI-DCCUJTHKSA-N |
| XLogP | 4.35 |
| TPSA | 197.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|