C26H24FN7O5S — CID 146335602
(2S)-2-amino-4-[[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazole-1-carbonyl]sulfanylamino]-4-oxobutanoic acid (PubChem CID 146335602) has the molecular formula C26H24FN7O5S and a molecular weight of 565.59 g/mol. Its IUPAC name is (2S)-2-amino-4-[[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazole-1-carbonyl]sulfanylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazole-1-carbonyl]sulfanylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146335602 |
| Molecular Formula | C26H24FN7O5S |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | (2S)-2-amino-4-[[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazole-1-carbonyl]sulfanylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4c3c(N)nn4C(=O)SNC(=O)C[C@H](N)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H24FN7O5S/c1-13-5-10-17(27)19(11-13)31-25(38)30-15-8-6-14(7-9-15)16-3-2-4-20-22(16)23(29)32-34(20)26(39)40-33-21(35)12-18(28)24(36)37/h2-11,18H,12,28H2,1H3,(H2,29,32)(H,33,35)(H,36,37)(H2,30,31,38)/t18-/m0/s1 |
| InChIKey | ITFBWBFWUMLJCN-SFHVURJKSA-N |
| XLogP | 3.91 |
| TPSA | 194.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|