C38H45FN8O7 — CID 146335567
(2S)-5-amino-2-[4-[[8-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-8-oxooctanoyl]amino]butanoylamino]-5-oxopentanoic acid (PubChem CID 146335567) has the molecular formula C38H45FN8O7 and a molecular weight of 744.83 g/mol. Its IUPAC name is (2S)-5-amino-2-[4-[[8-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-8-oxooctanoyl]amino]butanoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[4-[[8-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-8-oxooctanoyl]amino]butanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146335567 |
| Molecular Formula | C38H45FN8O7 |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | (2S)-5-amino-2-[4-[[8-[3-amino-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]indazol-1-yl]-8-oxooctanoyl]amino]butanoylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4c3c(N)nn4C(=O)CCCCCCC(=O)NCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C38H45FN8O7/c1-23-13-18-27(39)29(22-23)45-38(54)43-25-16-14-24(15-17-25)26-8-6-9-30-35(26)36(41)46-47(30)34(51)12-5-3-2-4-10-32(49)42-21-7-11-33(50)44-28(37(52)53)19-20-31(40)48/h6,8-9,13-18,22,28H,2-5,7,10-12,19-21H2,1H3,(H2,40,48)(H2,41,46)(H,42,49)(H,44,50)(H,52,53)(H2,43,45,54)/t28-/m0/s1 |
| InChIKey | SOVXWAOJZYMXGR-NDEPHWFRSA-N |
| XLogP | 5.09 |
| TPSA | 240.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|