C25H25ClN8O4S — CID 139517156
3-[2-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methylsulfanyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoic acid (PubChem CID 139517156) has the molecular formula C25H25ClN8O4S and a molecular weight of 569.05 g/mol. Its IUPAC name is 3-[2-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methylsulfanyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoic acid.
| Compound Name | 3-[2-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methylsulfanyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 139517156 |
| Molecular Formula | C25H25ClN8O4S |
| Molecular Weight | 569.05 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 3-[2-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methylsulfanyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoic acid |
| SMILES | CCn1c(CSc2nc3nc(C)c(CCC(=O)O)c(C)n3n2)nc2c1c(=O)[nH]c(=O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN8O4S/c1-4-32-18(12-39-24-30-23-27-13(2)17(9-10-19(35)36)14(3)34(23)31-24)28-21-20(32)22(37)29-25(38)33(21)11-15-5-7-16(26)8-6-15/h5-8H,4,9-12H2,1-3H3,(H,35,36)(H,29,37,38) |
| InChIKey | WNJAVRKKFWRVSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.05 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |